C23H22ClNO5 — CID 20896655
butyl 4-[(7-chloro-9-methoxy-1-benzoxepine-4-carbonyl)amino]benzoate (PubChem CID 20896655) has the molecular formula C23H22ClNO5 and a molecular weight of 427.88 g/mol. Its IUPAC name is butyl 4-[(7-chloro-9-methoxy-1-benzoxepine-4-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(7-chloro-9-methoxy-1-benzoxepine-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 20896655 |
| Molecular Formula | C23H22ClNO5 |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | butyl 4-[(7-chloro-9-methoxy-1-benzoxepine-4-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2=Cc3cc(Cl)cc(OC)c3OC=C2)cc1 |
| InChI | InChI=1S/C23H22ClNO5/c1-3-4-10-30-23(27)15-5-7-19(8-6-15)25-22(26)16-9-11-29-21-17(12-16)13-18(24)14-20(21)28-2/h5-9,11-14H,3-4,10H2,1-2H3,(H,25,26) |
| InChIKey | FJIILBYSWYAPNC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|