C13H18FNO4S2 — CID 20897854
(3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine (PubChem CID 20897854) has the molecular formula C13H18FNO4S2 and a molecular weight of 335.42 g/mol. Its IUPAC name is (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine.
| Compound Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine |
|---|---|
| PubChem CID | 20897854 |
| Molecular Formula | C13H18FNO4S2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (3S,4R)-4-(4-fluorophenyl)sulfonyl-1,1-dioxo-N-propylthiolan-3-amine |
| SMILES | CCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO4S2/c1-2-7-15-12-8-20(16,17)9-13(12)21(18,19)11-5-3-10(14)4-6-11/h3-6,12-13,15H,2,7-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | PWKDLXXKOBIIKE-STQMWFEESA-N |
| XLogP | 0.76 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |