C14H20FNO4S2 — CID 20897860
(3S,4R)-N-butan-2-yl-4-(4-fluorophenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 20897860) has the molecular formula C14H20FNO4S2 and a molecular weight of 349.45 g/mol. Its IUPAC name is (3S,4R)-N-butan-2-yl-4-(4-fluorophenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-N-butan-2-yl-4-(4-fluorophenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 20897860 |
| Molecular Formula | C14H20FNO4S2 |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | (3S,4R)-N-butan-2-yl-4-(4-fluorophenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | CCC(C)N[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNO4S2/c1-3-10(2)16-13-8-21(17,18)9-14(13)22(19,20)12-6-4-11(15)5-7-12/h4-7,10,13-14,16H,3,8-9H2,1-2H3/t10?,13-,14-/m0/s1 |
| InChIKey | BQSMDNZGVFIGAE-RYQGGHCKSA-N |
| XLogP | 1.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |