C24H25N3O3 — CID 20907951
2-[[4-(2,3-dihydroindole-1-carbonyl)phenyl]methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 20907951) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[[4-(2,3-dihydroindole-1-carbonyl)phenyl]methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-[[4-(2,3-dihydroindole-1-carbonyl)phenyl]methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 20907951 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[[4-(2,3-dihydroindole-1-carbonyl)phenyl]methyl]-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | O=C1C2CCCCN2C(=O)CN1Cc1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C24H25N3O3/c28-22-16-25(24(30)21-7-3-4-13-26(21)22)15-17-8-10-19(11-9-17)23(29)27-14-12-18-5-1-2-6-20(18)27/h1-2,5-6,8-11,21H,3-4,7,12-16H2 |
| InChIKey | FZZBMQHSDPSXDX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |