C19H19N3O6S — CID 20914050
N-(1,3-benzodioxol-5-ylmethyl)-1,4,7-trimethyl-2,3-dioxoquinoxaline-6-sulfonamide (PubChem CID 20914050) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1,4,7-trimethyl-2,3-dioxoquinoxaline-6-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1,4,7-trimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 20914050 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1,4,7-trimethyl-2,3-dioxoquinoxaline-6-sulfonamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)NCc1ccc3c(c1)OCO3)n(C)c(=O)c(=O)n2C |
| InChI | InChI=1S/C19H19N3O6S/c1-11-6-13-14(22(3)19(24)18(23)21(13)2)8-17(11)29(25,26)20-9-12-4-5-15-16(7-12)28-10-27-15/h4-8,20H,9-10H2,1-3H3 |
| InChIKey | ZEIFZWXOWMMARE-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|