C18H15N3O5S2 — CID 20917770
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)-N-methylthiophene-2-sulfonamide (PubChem CID 20917770) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)-N-methylthiophene-2-sulfonamide.
| Compound Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20917770 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)-N-methylthiophene-2-sulfonamide |
| SMILES | CN(Cc1ccco1)S(=O)(=O)c1ccc(CN2C(=O)c3cccnc3C2=O)s1 |
| InChI | InChI=1S/C18H15N3O5S2/c1-20(10-12-4-3-9-26-12)28(24,25)15-7-6-13(27-15)11-21-17(22)14-5-2-8-19-16(14)18(21)23/h2-9H,10-11H2,1H3 |
| InChIKey | JXROKBYCHRHOTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|