C20H17N3O5S — CID 20914328
4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide (PubChem CID 20914328) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20914328 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2ccc(CN3C(=O)c4cccnc4C3=O)cc2)o1 |
| InChI | InChI=1S/C20H17N3O5S/c1-13-4-7-15(28-13)11-22-29(26,27)16-8-5-14(6-9-16)12-23-19(24)17-3-2-10-21-18(17)20(23)25/h2-10,22H,11-12H2,1H3 |
| InChIKey | KBGGUKWPWMJIBQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|