C19H14FN3O5S — CID 20917809
2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 20917809) has the molecular formula C19H14FN3O5S and a molecular weight of 415.40 g/mol. Its IUPAC name is 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20917809 |
| Molecular Formula | C19H14FN3O5S |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(F)cc1S(=O)(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H14FN3O5S/c20-13-6-5-12(11-23-18(24)15-4-1-7-21-17(15)19(23)25)16(9-13)29(26,27)22-10-14-3-2-8-28-14/h1-9,22H,10-11H2 |
| InChIKey | CIHQSWNNXNYMMK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|