C22H17N3O5S — CID 20969986
6-[[4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20969986) has the molecular formula C22H17N3O5S and a molecular weight of 435.46 g/mol. Its IUPAC name is 6-[[4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20969986 |
| Molecular Formula | C22H17N3O5S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 6-[[4-(2,3-dihydro-1,4-benzoxazin-4-ylsulfonyl)phenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)N2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C22H17N3O5S/c26-21-17-4-3-11-23-20(17)22(27)24(21)14-15-7-9-16(10-8-15)31(28,29)25-12-13-30-19-6-2-1-5-18(19)25/h1-11H,12-14H2 |
| InChIKey | UJJRNYTYOAJRME-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|