C18H28NO5+ — CID 2093317
2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methoxy]propyl]azanium (PubChem CID 2093317) has the molecular formula C18H28NO5+ and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methoxy]propyl]azanium.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methoxy]propyl]azanium |
|---|---|
| PubChem CID | 2093317 |
| Molecular Formula | C18H28NO5+ |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methoxy]propyl]azanium |
| SMILES | O[C@@H](C[NH2+]CCc1ccc2c(c1)OCCO2)COC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H27NO5/c20-15(12-21-13-16-2-1-7-22-16)11-19-6-5-14-3-4-17-18(10-14)24-9-8-23-17/h3-4,10,15-16,19-20H,1-2,5-9,11-13H2/p+1/t15-,16+/m0/s1 |
| InChIKey | WDZPGYNTYXBNCM-JKSUJKDBSA-O |
| XLogP | 0.12 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|