About 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine
5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine (PubChem CID 20934689) has the molecular formula C17H15FN2O3S
and a molecular weight of 346.38 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine |
| PubChem CID | 20934689 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine |
| SMILES | COc1ccc(NC2=NS(=O)(=O)C(c3ccc(F)cc3)=C2C)cc1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-11-16(12-3-5-13(18)6-4-12)24(21,22)20-17(11)19-14-7-9-15(23-2)10-8-14/h3-10H,1-2H3,(H,19,20) |
| InChIKey | RBELQCOVNNQHHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine?
The IUPAC name of 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine (CID 20934689) is 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine.
What is the SMILES notation for 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine?
The canonical SMILES for 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine is COc1ccc(NC2=NS(=O)(=O)C(c3ccc(F)cc3)=C2C)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine?
The InChIKey is RBELQCOVNNQHHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O3S/c1-11-16(12-3-5-13(18)6-4-12)24(21,22)20-17(11)19-14-7-9-15(23-2)10-8-14/h3-10H,1-2H3,(H,19,20).
What are the key properties of 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine?
5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine has a molecular weight of 346.38 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-N-(4-methoxyphenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-amine is sourced from PubChem (CID 20934689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).