C26H24N2O3 — CID 2093881
3-[(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 2093881) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2093881 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3-[(2R)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(=O)[C@@H](C)N2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C26H24N2O3/c1-17-14-15-20(16-18(17)2)23(29)19(3)28-24(30)26(27-25(28)31,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-16,19H,1-3H3,(H,27,31)/t19-/m1/s1 |
| InChIKey | OCEKSMCYORKEBF-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|