C24H27N3O4 — CID 54332150
1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)ethyl 2-piperidin-1-ylacetate (PubChem CID 54332150) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)ethyl 2-piperidin-1-ylacetate.
| Compound Name | 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)ethyl 2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 54332150 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)ethyl 2-piperidin-1-ylacetate |
| SMILES | CC(OC(=O)CN1CCCCC1)N1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H27N3O4/c1-18(31-21(28)17-26-15-9-4-10-16-26)27-22(29)24(25-23(27)30,19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-3,5-8,11-14,18H,4,9-10,15-17H2,1H3,(H,25,30) |
| InChIKey | SZCDYQSKQKYDEY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|