C22H22N4O — CID 20941602
1-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one (PubChem CID 20941602) has the molecular formula C22H22N4O and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one.
| Compound Name | 1-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 20941602 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one |
| SMILES | Cc1ccc(-n2ccnc(NCCc3c[nH]c4ccccc34)c2=O)cc1C |
| InChI | InChI=1S/C22H22N4O/c1-15-7-8-18(13-16(15)2)26-12-11-24-21(22(26)27)23-10-9-17-14-25-20-6-4-3-5-19(17)20/h3-8,11-14,25H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | MMFVXPXAECAEBE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |