C20H17BrN4O — CID 46337577
1-(4-bromophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one (PubChem CID 46337577) has the molecular formula C20H17BrN4O and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one.
| Compound Name | 1-(4-bromophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one |
|---|---|
| PubChem CID | 46337577 |
| Molecular Formula | C20H17BrN4O |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-[2-(1H-indol-3-yl)ethylamino]pyrazin-2-one |
| SMILES | O=c1c(NCCc2c[nH]c3ccccc23)nccn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H17BrN4O/c21-15-5-7-16(8-6-15)25-12-11-23-19(20(25)26)22-10-9-14-13-24-18-4-2-1-3-17(14)18/h1-8,11-13,24H,9-10H2,(H,22,23) |
| InChIKey | UIKBMBCCXKCNGF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |