C19H16N2O3S2 — CID 20944781
2-(5,5-dioxophenothiazin-10-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 20944781) has the molecular formula C19H16N2O3S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(5,5-dioxophenothiazin-10-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(5,5-dioxophenothiazin-10-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 20944781 |
| Molecular Formula | C19H16N2O3S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-(5,5-dioxophenothiazin-10-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN1c2ccccc2S(=O)(=O)c2ccccc21)NCc1cccs1 |
| InChI | InChI=1S/C19H16N2O3S2/c22-19(20-12-14-6-5-11-25-14)13-21-15-7-1-3-9-17(15)26(23,24)18-10-4-2-8-16(18)21/h1-11H,12-13H2,(H,20,22) |
| InChIKey | SBDOWTVHRSZWJR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |