C26H30FN5O2 — CID 20954136
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-7-methoxy-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide (PubChem CID 20954136) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-7-methoxy-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-7-methoxy-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 20954136 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-7-methoxy-4,5-dihydro-2H-benzo[g]indazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)CCc1c-2n[nH]c1C(=O)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H30FN5O2/c1-34-21-8-10-22-18(17-21)3-9-23-24(22)29-30-25(23)26(33)28-11-2-12-31-13-15-32(16-14-31)20-6-4-19(27)5-7-20/h4-8,10,17H,2-3,9,11-16H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | IHCYWBPHUHVDIU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|