C20H26N2O3S — CID 20954950
N-[3-(cyclooctylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide (PubChem CID 20954950) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[3-(cyclooctylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide.
| Compound Name | N-[3-(cyclooctylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide |
|---|---|
| PubChem CID | 20954950 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[3-(cyclooctylcarbamoyl)phenyl]-2,3-dihydro-1,4-oxathiine-6-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)NC2CCCCCCC2)c1)C1=CSCCO1 |
| InChI | InChI=1S/C20H26N2O3S/c23-19(21-16-8-4-2-1-3-5-9-16)15-7-6-10-17(13-15)22-20(24)18-14-26-12-11-25-18/h6-7,10,13-14,16H,1-5,8-9,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | PBEPEKHSLOQXDW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |