C21H21ClFN3O3 — CID 20955920
N-(4-chlorophenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide (PubChem CID 20955920) has the molecular formula C21H21ClFN3O3 and a molecular weight of 417.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 20955920 |
| Molecular Formula | C21H21ClFN3O3 |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(4-chlorophenyl)-4-[4-[(4-fluorophenyl)methyl]-2,3-dioxopiperazin-1-yl]butanamide |
| SMILES | O=C(CCCN1CCN(Cc2ccc(F)cc2)C(=O)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClFN3O3/c22-16-5-9-18(10-6-16)24-19(27)2-1-11-25-12-13-26(21(29)20(25)28)14-15-3-7-17(23)8-4-15/h3-10H,1-2,11-14H2,(H,24,27) |
| InChIKey | NCBBVWDRTAHMDU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|