C22H14ClFN2O3S — CID 2096617
2-chloro-N-[3-[(E)-2-cyano-2-(4-fluorophenyl)sulfonylethenyl]phenyl]benzamide (PubChem CID 2096617) has the molecular formula C22H14ClFN2O3S and a molecular weight of 440.88 g/mol. Its IUPAC name is 2-chloro-N-[3-[(E)-2-cyano-2-(4-fluorophenyl)sulfonylethenyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(E)-2-cyano-2-(4-fluorophenyl)sulfonylethenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2096617 |
| Molecular Formula | C22H14ClFN2O3S |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 2-chloro-N-[3-[(E)-2-cyano-2-(4-fluorophenyl)sulfonylethenyl]phenyl]benzamide |
| SMILES | N#C/C(=C\c1cccc(NC(=O)c2ccccc2Cl)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H14ClFN2O3S/c23-21-7-2-1-6-20(21)22(27)26-17-5-3-4-15(12-17)13-19(14-25)30(28,29)18-10-8-16(24)9-11-18/h1-13H,(H,26,27)/b19-13+ |
| InChIKey | JPWBEQNNRNVLHI-CPNJWEJPSA-N |
| XLogP | 5.07 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|