C27H34N2O3 — CID 20967723
4-benzyl-3-(4-butoxyphenyl)-1-cyclohexylpiperazine-2,5-dione (PubChem CID 20967723) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-benzyl-3-(4-butoxyphenyl)-1-cyclohexylpiperazine-2,5-dione.
| Compound Name | 4-benzyl-3-(4-butoxyphenyl)-1-cyclohexylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 20967723 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 4-benzyl-3-(4-butoxyphenyl)-1-cyclohexylpiperazine-2,5-dione |
| SMILES | CCCCOc1ccc(C2C(=O)N(C3CCCCC3)CC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H34N2O3/c1-2-3-18-32-24-16-14-22(15-17-24)26-27(31)28(23-12-8-5-9-13-23)20-25(30)29(26)19-21-10-6-4-7-11-21/h4,6-7,10-11,14-17,23,26H,2-3,5,8-9,12-13,18-20H2,1H3 |
| InChIKey | XNLLWIPTUPJKKI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|