C30H40N2O3 — CID 92695767
(3S)-1-cyclohexyl-3-(4-hexoxyphenyl)-4-[(4-methylphenyl)methyl]piperazine-2,5-dione (PubChem CID 92695767) has the molecular formula C30H40N2O3 and a molecular weight of 476.66 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-3-(4-hexoxyphenyl)-4-[(4-methylphenyl)methyl]piperazine-2,5-dione.
| Compound Name | (3S)-1-cyclohexyl-3-(4-hexoxyphenyl)-4-[(4-methylphenyl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 92695767 |
| Molecular Formula | C30H40N2O3 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | (3S)-1-cyclohexyl-3-(4-hexoxyphenyl)-4-[(4-methylphenyl)methyl]piperazine-2,5-dione |
| SMILES | CCCCCCOc1ccc([C@H]2C(=O)N(C3CCCCC3)CC(=O)N2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H40N2O3/c1-3-4-5-9-20-35-27-18-16-25(17-19-27)29-30(34)31(26-10-7-6-8-11-26)22-28(33)32(29)21-24-14-12-23(2)13-15-24/h12-19,26,29H,3-11,20-22H2,1-2H3/t29-/m0/s1 |
| InChIKey | VCHDNMVPNXYWAK-LJAQVGFWSA-N |
| XLogP | 6.20 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|