C32H44N2O5 — CID 92695775
(3S)-1-cyclohexyl-4-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-hexoxyphenyl)piperazine-2,5-dione (PubChem CID 92695775) has the molecular formula C32H44N2O5 and a molecular weight of 536.71 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-4-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-hexoxyphenyl)piperazine-2,5-dione.
| Compound Name | (3S)-1-cyclohexyl-4-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-hexoxyphenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 92695775 |
| Molecular Formula | C32H44N2O5 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | (3S)-1-cyclohexyl-4-[2-(3,4-dimethoxyphenyl)ethyl]-3-(4-hexoxyphenyl)piperazine-2,5-dione |
| SMILES | CCCCCCOc1ccc([C@H]2C(=O)N(C3CCCCC3)CC(=O)N2CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H44N2O5/c1-4-5-6-10-21-39-27-16-14-25(15-17-27)31-32(36)34(26-11-8-7-9-12-26)23-30(35)33(31)20-19-24-13-18-28(37-2)29(22-24)38-3/h13-18,22,26,31H,4-12,19-21,23H2,1-3H3/t31-/m0/s1 |
| InChIKey | FFVNJKSJSXAQFX-HKBQPEDESA-N |
| XLogP | 5.95 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|