C16H24N2O2S2 — CID 20974420
N-butyl-2-[6-(2-methylpropyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide (PubChem CID 20974420) has the molecular formula C16H24N2O2S2 and a molecular weight of 340.51 g/mol. Its IUPAC name is N-butyl-2-[6-(2-methylpropyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[6-(2-methylpropyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide |
|---|---|
| PubChem CID | 20974420 |
| Molecular Formula | C16H24N2O2S2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-butyl-2-[6-(2-methylpropyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1C(=O)CSc2sc(CC(C)C)cc21 |
| InChI | InChI=1S/C16H24N2O2S2/c1-4-5-6-17-14(19)9-18-13-8-12(7-11(2)3)22-16(13)21-10-15(18)20/h8,11H,4-7,9-10H2,1-3H3,(H,17,19) |
| InChIKey | DANBAHSEMWLXRP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|