C21H27N3O5S3 — CID 46387706
N-[(4-butoxyphenyl)methyl]-2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide (PubChem CID 46387706) has the molecular formula C21H27N3O5S3 and a molecular weight of 497.66 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46387706 |
| Molecular Formula | C21H27N3O5S3 |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]acetamide |
| SMILES | CCCCOc1ccc(CNC(=O)CN2C(=O)CSc3sc(S(=O)(=O)N(C)C)cc32)cc1 |
| InChI | InChI=1S/C21H27N3O5S3/c1-4-5-10-29-16-8-6-15(7-9-16)12-22-18(25)13-24-17-11-20(32(27,28)23(2)3)31-21(17)30-14-19(24)26/h6-9,11H,4-5,10,12-14H2,1-3H3,(H,22,25) |
| InChIKey | QJTHZKFGYKFNNA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|