C13H19N3O5S3 — CID 46387681
2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 46387681) has the molecular formula C13H19N3O5S3 and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 46387681 |
| Molecular Formula | C13H19N3O5S3 |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-[6-(dimethylsulfamoyl)-2-oxothieno[2,3-b][1,4]thiazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)CSc2sc(S(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C13H19N3O5S3/c1-15(2)24(19,20)12-6-9-13(23-12)22-8-11(18)16(9)7-10(17)14-4-5-21-3/h6H,4-5,7-8H2,1-3H3,(H,14,17) |
| InChIKey | HAQVTXLBMIMBGA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|