C21H26N4O4S3 — CID 46387656
N-[[4-(dimethylamino)phenyl]methyl]-2-(2-oxo-6-pyrrolidin-1-ylsulfonylthieno[2,3-b][1,4]thiazin-1-yl)acetamide (PubChem CID 46387656) has the molecular formula C21H26N4O4S3 and a molecular weight of 494.66 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(2-oxo-6-pyrrolidin-1-ylsulfonylthieno[2,3-b][1,4]thiazin-1-yl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(2-oxo-6-pyrrolidin-1-ylsulfonylthieno[2,3-b][1,4]thiazin-1-yl)acetamide |
|---|---|
| PubChem CID | 46387656 |
| Molecular Formula | C21H26N4O4S3 |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(2-oxo-6-pyrrolidin-1-ylsulfonylthieno[2,3-b][1,4]thiazin-1-yl)acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)CN2C(=O)CSc3sc(S(=O)(=O)N4CCCC4)cc32)cc1 |
| InChI | InChI=1S/C21H26N4O4S3/c1-23(2)16-7-5-15(6-8-16)12-22-18(26)13-25-17-11-20(31-21(17)30-14-19(25)27)32(28,29)24-9-3-4-10-24/h5-8,11H,3-4,9-10,12-14H2,1-2H3,(H,22,26) |
| InChIKey | XFEUGDKSQWMBIB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|