C24H29N3O3S — CID 20974471
N-[(4-butoxyphenyl)methyl]-1-(6H-thieno[2,3-b]pyrrole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 20974471) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-1-(6H-thieno[2,3-b]pyrrole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-1-(6H-thieno[2,3-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20974471 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-1-(6H-thieno[2,3-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | CCCCOc1ccc(CNC(=O)C2CCN(C(=O)c3cc4ccsc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-2-3-13-30-20-6-4-17(5-7-20)16-25-22(28)18-8-11-27(12-9-18)24(29)21-15-19-10-14-31-23(19)26-21/h4-7,10,14-15,18,26H,2-3,8-9,11-13,16H2,1H3,(H,25,28) |
| InChIKey | RJJURHFRAJZREM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|