About 2-methylheptane;propan-2-amine;hydrochloride
2-methylheptane;propan-2-amine;hydrochloride (PubChem CID 20975779) has the molecular formula C11H28ClN
and a molecular weight of 209.81 g/mol. Its IUPAC name is 2-methylheptane;propan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-methylheptane;propan-2-amine;hydrochloride |
| PubChem CID | 20975779 |
| Molecular Formula | C11H28ClN |
| Molecular Weight | 209.81 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-methylheptane;propan-2-amine;hydrochloride |
| SMILES | CC(C)N.CCCCCC(C)C.Cl |
| InChI | InChI=1S/C8H18.C3H9N.ClH/c1-4-5-6-7-8(2)3;1-3(2)4;/h8H,4-7H2,1-3H3;3H,4H2,1-2H3;1H |
| InChIKey | XONUDOCDJGHAAM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptane;propan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptane;propan-2-amine;hydrochloride?
The IUPAC name of 2-methylheptane;propan-2-amine;hydrochloride (CID 20975779) is 2-methylheptane;propan-2-amine;hydrochloride.
What is the SMILES notation for 2-methylheptane;propan-2-amine;hydrochloride?
The canonical SMILES for 2-methylheptane;propan-2-amine;hydrochloride is CC(C)N.CCCCCC(C)C.Cl.
What is the InChIKey of 2-methylheptane;propan-2-amine;hydrochloride?
The InChIKey is XONUDOCDJGHAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C3H9N.ClH/c1-4-5-6-7-8(2)3;1-3(2)4;/h8H,4-7H2,1-3H3;3H,4H2,1-2H3;1H.
What are the key properties of 2-methylheptane;propan-2-amine;hydrochloride?
2-methylheptane;propan-2-amine;hydrochloride has a molecular weight of 209.81 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptane;propan-2-amine;hydrochloride is sourced from PubChem (CID 20975779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).