C25H45N3O2 — CID 20981689
morpholine;1-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazin-1-yl]ethanone (PubChem CID 20981689) has the molecular formula C25H45N3O2 and a molecular weight of 419.65 g/mol. Its IUPAC name is morpholine;1-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazin-1-yl]ethanone.
| Compound Name | morpholine;1-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 20981689 |
| Molecular Formula | C25H45N3O2 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.35 |
| IUPAC Name | morpholine;1-[4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazin-1-yl]ethanone |
| SMILES | C1COCCN1.CC(=O)N1CCN(CC=C(C)CCC=C(C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C21H36N2O.C4H9NO/c1-18(2)8-6-9-19(3)10-7-11-20(4)12-13-22-14-16-23(17-15-22)21(5)24;1-3-6-4-2-5-1/h8,10,12H,6-7,9,11,13-17H2,1-5H3;5H,1-4H2 |
| InChIKey | BSHDDUKIHYFMLD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|