C11H16O3 — CID 20982130
2,5-dimethoxy-4-oxatricyclo[4.3.1.03,10]dec-8-ene (PubChem CID 20982130) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,5-dimethoxy-4-oxatricyclo[4.3.1.03,10]dec-8-ene.
| Compound Name | 2,5-dimethoxy-4-oxatricyclo[4.3.1.03,10]dec-8-ene |
|---|---|
| PubChem CID | 20982130 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2,5-dimethoxy-4-oxatricyclo[4.3.1.03,10]dec-8-ene |
| SMILES | COC1OC2C(OC)C3C=CCC1C32 |
| InChI | InChI=1S/C11H16O3/c1-12-9-6-4-3-5-7-8(6)10(9)14-11(7)13-2/h3-4,6-11H,5H2,1-2H3 |
| InChIKey | VONWCSNSLYGUFU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|