C11H16O2 — CID 14945367
(4aR,4bS,8aR,9aS)-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran (PubChem CID 14945367) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (4aR,4bS,8aR,9aS)-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran.
| Compound Name | (4aR,4bS,8aR,9aS)-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 14945367 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (4aR,4bS,8aR,9aS)-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran |
| SMILES | C1=CC[C@H]2O[C@@H]3OCCC[C@@H]3[C@@H]2C1 |
| InChI | InChI=1S/C11H16O2/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-2,8-11H,3-7H2/t8-,9+,10+,11-/m0/s1 |
| InChIKey | UHUDSYNIHIWUGK-ZDCRXTMVSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|