C18H22BrN2O+ — CID 2098274
[(1S)-2-[[2-(4-bromophenyl)acetyl]amino]-1-phenylethyl]-dimethylazanium (PubChem CID 2098274) has the molecular formula C18H22BrN2O+ and a molecular weight of 362.29 g/mol. Its IUPAC name is [(1S)-2-[[2-(4-bromophenyl)acetyl]amino]-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1S)-2-[[2-(4-bromophenyl)acetyl]amino]-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2098274 |
| Molecular Formula | C18H22BrN2O+ |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | [(1S)-2-[[2-(4-bromophenyl)acetyl]amino]-1-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@H](CNC(=O)Cc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H21BrN2O/c1-21(2)17(15-6-4-3-5-7-15)13-20-18(22)12-14-8-10-16(19)11-9-14/h3-11,17H,12-13H2,1-2H3,(H,20,22)/p+1/t17-/m1/s1 |
| InChIKey | FHCPLXLTFFPFFI-QGZVFWFLSA-O |
| XLogP | 1.99 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |