C19H27N3O4S — CID 20990028
4-amino-N-[2-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]ethyl]benzenesulfonamide (PubChem CID 20990028) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-amino-N-[2-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20990028 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 4-amino-N-[2-[3-[2-(dimethylamino)ethoxy]-4-methoxyphenyl]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc(N)cc2)cc1OCCN(C)C |
| InChI | InChI=1S/C19H27N3O4S/c1-22(2)12-13-26-19-14-15(4-9-18(19)25-3)10-11-21-27(23,24)17-7-5-16(20)6-8-17/h4-9,14,21H,10-13,20H2,1-3H3 |
| InChIKey | YEQZJIRYSUJKLJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|