C17H17BrClNO3 — CID 20990293
N-[[3-bromo-5-chloro-2-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine (PubChem CID 20990293) has the molecular formula C17H17BrClNO3 and a molecular weight of 398.68 g/mol. Its IUPAC name is N-[[3-bromo-5-chloro-2-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[3-bromo-5-chloro-2-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 20990293 |
| Molecular Formula | C17H17BrClNO3 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | N-[[3-bromo-5-chloro-2-[2-(2,6-dimethylphenoxy)ethoxy]phenyl]methylidene]hydroxylamine |
| SMILES | Cc1cccc(C)c1OCCOc1c(Br)cc(Cl)cc1C=NO |
| InChI | InChI=1S/C17H17BrClNO3/c1-11-4-3-5-12(2)16(11)22-6-7-23-17-13(10-20-21)8-14(19)9-15(17)18/h3-5,8-10,21H,6-7H2,1-2H3 |
| InChIKey | QCLSHFZGTOPECE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|