C17H15BrClNO2 — CID 20986034
3-bromo-5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzonitrile (PubChem CID 20986034) has the molecular formula C17H15BrClNO2 and a molecular weight of 380.67 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzonitrile.
| Compound Name | 3-bromo-5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 20986034 |
| Molecular Formula | C17H15BrClNO2 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 3-bromo-5-chloro-2-[2-(2,3-dimethylphenoxy)ethoxy]benzonitrile |
| SMILES | Cc1cccc(OCCOc2c(Br)cc(Cl)cc2C#N)c1C |
| InChI | InChI=1S/C17H15BrClNO2/c1-11-4-3-5-16(12(11)2)21-6-7-22-17-13(10-20)8-14(19)9-15(17)18/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | LJTPUYMKBQPJGR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|