C16H9BrF3N3O2 — CID 21003314
N-(1,3-benzodioxol-5-yl)-6-bromo-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003314) has the molecular formula C16H9BrF3N3O2 and a molecular weight of 412.17 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-bromo-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-bromo-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003314 |
| Molecular Formula | C16H9BrF3N3O2 |
| Molecular Weight | 412.17 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-bromo-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | FC(F)(F)c1nc(Nc2ccc3c(c2)OCO3)c2cc(Br)ccc2n1 |
| InChI | InChI=1S/C16H9BrF3N3O2/c17-8-1-3-11-10(5-8)14(23-15(22-11)16(18,19)20)21-9-2-4-12-13(6-9)25-7-24-12/h1-6H,7H2,(H,21,22,23) |
| InChIKey | LQIZXXGIRXBRRP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.17 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |