C24H24FN7 — CID 21004285
N-[(4-fluorophenyl)methyl]-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazolin-4-amine (PubChem CID 21004285) has the molecular formula C24H24FN7 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazolin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 21004285 |
| Molecular Formula | C24H24FN7 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]quinazolin-4-amine |
| SMILES | Fc1ccc(CNc2nc(CN3CCN(c4ncccn4)CC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H24FN7/c25-19-8-6-18(7-9-19)16-28-23-20-4-1-2-5-21(20)29-22(30-23)17-31-12-14-32(15-13-31)24-26-10-3-11-27-24/h1-11H,12-17H2,(H,28,29,30) |
| InChIKey | MSIQFIFQGZVNTK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |