C20H23N5O3S — CID 21004190
4-[[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]benzenesulfonamide (PubChem CID 21004190) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 4-[[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 21004190 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 4-[[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc(CN3CCOCC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H23N5O3S/c21-29(26,27)16-7-5-15(6-8-16)13-22-20-17-3-1-2-4-18(17)23-19(24-20)14-25-9-11-28-12-10-25/h1-8H,9-14H2,(H2,21,26,27)(H,22,23,24) |
| InChIKey | HFSNKDQISHLEJV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |