C19H20N4O2 — CID 21004213
4-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]phenol (PubChem CID 21004213) has the molecular formula C19H20N4O2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]phenol.
| Compound Name | 4-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 21004213 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[[2-(morpholin-4-ylmethyl)quinazolin-4-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2nc(CN3CCOCC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C19H20N4O2/c24-15-7-5-14(6-8-15)20-19-16-3-1-2-4-17(16)21-18(22-19)13-23-9-11-25-12-10-23/h1-8,24H,9-13H2,(H,20,21,22) |
| InChIKey | IMUGLSNBACERMN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|