C17H18N4OS — CID 170560487
2-(morpholin-4-ylmethyl)-N-phenylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 170560487) has the molecular formula C17H18N4OS and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-N-phenylthieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-(morpholin-4-ylmethyl)-N-phenylthieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170560487 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-N-phenylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(Nc2nc(CN3CCOCC3)nc3ccsc23)cc1 |
| InChI | InChI=1S/C17H18N4OS/c1-2-4-13(5-3-1)18-17-16-14(6-11-23-16)19-15(20-17)12-21-7-9-22-10-8-21/h1-6,11H,7-10,12H2,(H,18,19,20) |
| InChIKey | FSKJLMBDJJTLGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |