C24H23N3O3S2 — CID 21011851
4-ethylsulfonyl-2-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol (PubChem CID 21011851) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol.
| Compound Name | 4-ethylsulfonyl-2-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 21011851 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 4-ethylsulfonyl-2-[[5-(5,6,7,8-tetrahydronaphthalen-2-yl)thieno[2,3-d]pyrimidin-4-yl]amino]phenol |
| SMILES | CCS(=O)(=O)c1ccc(O)c(Nc2ncnc3scc(-c4ccc5c(c4)CCCC5)c23)c1 |
| InChI | InChI=1S/C24H23N3O3S2/c1-2-32(29,30)18-9-10-21(28)20(12-18)27-23-22-19(13-31-24(22)26-14-25-23)17-8-7-15-5-3-4-6-16(15)11-17/h7-14,28H,2-6H2,1H3,(H,25,26,27) |
| InChIKey | GZIVHGVFEIVRSF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|