C22H21N3O3S2 — CID 21011852
2-[[5-(2,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-ethylsulfonylphenol (PubChem CID 21011852) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[[5-(2,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-ethylsulfonylphenol.
| Compound Name | 2-[[5-(2,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-ethylsulfonylphenol |
|---|---|
| PubChem CID | 21011852 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[[5-(2,4-dimethylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-4-ethylsulfonylphenol |
| SMILES | CCS(=O)(=O)c1ccc(O)c(Nc2ncnc3scc(-c4ccc(C)cc4C)c23)c1 |
| InChI | InChI=1S/C22H21N3O3S2/c1-4-30(27,28)15-6-8-19(26)18(10-15)25-21-20-17(11-29-22(20)24-12-23-21)16-7-5-13(2)9-14(16)3/h5-12,26H,4H2,1-3H3,(H,23,24,25) |
| InChIKey | FEJOTKMHJNWBOJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|