C21H22N2O4S2 — CID 52791222
2-(2,4-dimethylphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 52791222) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 52791222 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2sc(-c3ccc(C)cc3C)nc2C)c1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-5-29(26,27)15-7-9-18(24)17(11-15)23-20(25)19-14(4)22-21(28-19)16-8-6-12(2)10-13(16)3/h6-11,24H,5H2,1-4H3,(H,23,25) |
| InChIKey | BIXHAKWGLOCLBR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|