C19H25N3O4S2 — CID 56504628
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-methyl-2-(2-methylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 56504628) has the molecular formula C19H25N3O4S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-methyl-2-(2-methylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-methyl-2-(2-methylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56504628 |
| Molecular Formula | C19H25N3O4S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-4-methyl-2-(2-methylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(CC(C)C)sc1C(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C19H25N3O4S2/c1-12(2)10-17-20-13(3)18(27-17)19(24)21-15-11-14(6-7-16(15)23)28(25,26)22-8-4-5-9-22/h6-7,11-12,23H,4-5,8-10H2,1-3H3,(H,21,24) |
| InChIKey | GOJNWPINOKSVMG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|