C11H21NO3 — CID 21017376
tert-butyl 3-amino-2-hydroxy-3-(2-methylcyclopropyl)propanoate (PubChem CID 21017376) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl 3-amino-2-hydroxy-3-(2-methylcyclopropyl)propanoate.
| Compound Name | tert-butyl 3-amino-2-hydroxy-3-(2-methylcyclopropyl)propanoate |
|---|---|
| PubChem CID | 21017376 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl 3-amino-2-hydroxy-3-(2-methylcyclopropyl)propanoate |
| SMILES | CC1CC1C(N)C(O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-6-5-7(6)8(12)9(13)10(14)15-11(2,3)4/h6-9,13H,5,12H2,1-4H3 |
| InChIKey | ARQDNHOVXCLWOZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |