C15H27N4OS+ — CID 2101833
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium (PubChem CID 2101833) has the molecular formula C15H27N4OS+ and a molecular weight of 311.48 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2101833 |
| Molecular Formula | C15H27N4OS+ |
| Molecular Weight | 311.48 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]ethyl-(2-hydroxyethyl)azanium |
| SMILES | C=CCn1c(SCC[NH2+]CCO)nnc1C1CCCCC1 |
| InChI | InChI=1S/C15H26N4OS/c1-2-10-19-14(13-6-4-3-5-7-13)17-18-15(19)21-12-9-16-8-11-20/h2,13,16,20H,1,3-12H2/p+1 |
| InChIKey | FQPAZEFUGNZZQA-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 67.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|