C12H14F3NO4S — CID 21020685
(Z)-2,2,2-trifluoro-1-(4-methoxyphenyl)-N-propylsulfanyloxyperoxyethanimine (PubChem CID 21020685) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is (Z)-2,2,2-trifluoro-1-(4-methoxyphenyl)-N-propylsulfanyloxyperoxyethanimine.
| Compound Name | (Z)-2,2,2-trifluoro-1-(4-methoxyphenyl)-N-propylsulfanyloxyperoxyethanimine |
|---|---|
| PubChem CID | 21020685 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (Z)-2,2,2-trifluoro-1-(4-methoxyphenyl)-N-propylsulfanyloxyperoxyethanimine |
| SMILES | CCCSOOO/N=C(/c1ccc(OC)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO4S/c1-3-8-21-20-19-18-16-11(12(13,14)15)9-4-6-10(17-2)7-5-9/h4-7H,3,8H2,1-2H3/b16-11- |
| InChIKey | SJEVSBDMXBMTNP-WJDWOHSUSA-N |
| XLogP | 3.90 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|