About chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine
chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine (PubChem CID 21024789) has the molecular formula C14H9ClN2OPt
and a molecular weight of 451.77 g/mol. Its IUPAC name is chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine.
Molecular Properties
| Compound Name | chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine |
| PubChem CID | 21024789 |
| Molecular Formula | C14H9ClN2OPt |
| Molecular Weight | 451.77 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine |
| SMILES | Cl[Pt+].[c-]1c(-c2ccccn2)coc1-c1ccccn1 |
| InChI | InChI=1S/C14H9N2O.ClH.Pt/c1-3-7-15-12(5-1)11-9-14(17-10-11)13-6-2-4-8-16-13;;/h1-8,10H;1H;/q-1;;+2/p-1 |
| InChIKey | ONVOOPGQZPHLHN-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine?
The IUPAC name of chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine (CID 21024789) is chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine.
What is the SMILES notation for chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine?
The canonical SMILES for chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine is Cl[Pt+].[c-]1c(-c2ccccn2)coc1-c1ccccn1.
What is the InChIKey of chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine?
The InChIKey is ONVOOPGQZPHLHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H9N2O.ClH.Pt/c1-3-7-15-12(5-1)11-9-14(17-10-11)13-6-2-4-8-16-13;;/h1-8,10H;1H;/q-1;;+2/p-1.
What are the key properties of chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine?
chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine has a molecular weight of 451.77 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum(1+);2-(2-pyridin-2-yl-3H-furan-3-id-4-yl)pyridine is sourced from PubChem (CID 21024789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).