C21H16ClN3OPt — CID 21024857
chloroplatinum(1+);8-methoxy-2-methyl-5,7-dipyridin-2-yl-6H-quinolin-6-ide (PubChem CID 21024857) has the molecular formula C21H16ClN3OPt and a molecular weight of 556.91 g/mol. Its IUPAC name is chloroplatinum(1+);8-methoxy-2-methyl-5,7-dipyridin-2-yl-6H-quinolin-6-ide.
| Compound Name | chloroplatinum(1+);8-methoxy-2-methyl-5,7-dipyridin-2-yl-6H-quinolin-6-ide |
|---|---|
| PubChem CID | 21024857 |
| Molecular Formula | C21H16ClN3OPt |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | chloroplatinum(1+);8-methoxy-2-methyl-5,7-dipyridin-2-yl-6H-quinolin-6-ide |
| SMILES | COc1c(-c2ccccn2)[c-]c(-c2ccccn2)c2ccc(C)nc12.Cl[Pt+] |
| InChI | InChI=1S/C21H16N3O.ClH.Pt/c1-14-9-10-15-16(18-7-3-5-11-22-18)13-17(19-8-4-6-12-23-19)21(25-2)20(15)24-14;;/h3-12H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | RCVUOKMZAKHKBW-UHFFFAOYSA-M |
| XLogP | 5.16 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|